11 markeasy
Which of these pure compounds has hydrogen bonding in the liquid state?
Choose your answer
1,1,1-trichloroethane, CH3CCl3
trimethylamine, (CH3)3N
hydrogen fluoride, HF
hydrogen sulfide, H2S
Chemistry
Intermolecular Forces — Multiple-Choice Questions (Edexcel IAL Chemistry): Exam Questions
Exam code:YCH1111 questions · 12 marks · ≈ 12 min
21 markeasy
Which of these isomers has the highest boiling temperature?
Choose your answer
32 markseasy
(a)
This question is about alkanes.
Which of these alkanes has the highest boiling temperature?
Choose your answer
butane
hexane
pentane
propane
(b)
Which of these alkanes has the lowest boiling temperature?
(1 mark)
Choose your answer
41 markmedium
Which of these isomers with the formula C8H18 has the lowest boiling temperature?
Choose your answer
CH3CH(CH3)CH2CH2CH(CH3)CH3
CH3CH(CH3)CH2CH2CH2CH2CH3
CH3C(CH3)2CH2CH(CH3)CH3
CH3CH2CH2CH2CH2CH2CH2CH3
51 markmedium
Which sequence shows the molecules in order of increasing boiling temperature?
Choose your answer
H2O < Br2 < Cl2 < CH4
Br2 < CH4 < Cl2 < H2O
Cl2 < CH4 < H2O < Br2
CH4 < Cl2 < Br2 < H2O
61 markmedium
The viscosities of four liquid organic compounds are compared by placing the liquids in separate identical tubes, each with an air bubble at the top.
The tubes are inverted, and the times measured for the air bubble to travel the length of the tube. For which compound does the air bubble take the longest time?
Choose your answer
71 markmedium
Which is not correct about ice?
Choose your answer
ice has a lower density than water
H2O molecules are further apart in ice than in water
the H−O−H bond angle is the same in ice and in water
H2O molecules in ice are held together by hydrogen bonds
81 markmedium
Which intermolecular forces exist between the molecules of the compound shown?
Choose your answer
hydrogen bonding and London forces only
hydrogen bonding and permanent dipole‐permanent dipole forces only
London forces and permanent dipole‐permanent dipole forces only
hydrogen bonding, permanent dipole‐permanent dipole forces and London forces
91 markmedium
Which solvent dissolves the greatest amount of hydrocarbon C35H72?
Choose your answer
butan‐1‐ol
ethanoic acid
hexane
water
101 markmedium
Which row shows the hydrogen halides in order of increasing boiling temperature?
| LowestHighest | |||||
|---|---|---|---|---|---|
| ☐ | A | HF | HCl | HBr | HI |
| ☐ | B | HI | HBr | HCl | HF |
| ☐ | C | HCl | HBr | HI | HF |
| ☐ | D | HF | HI | HBr | HCl |
Choose your answer
111 markhard
Pentane and 2,2-dimethylpropane are structural isomers with molecular formula C5H12.
| Alkane | Boiling point / °C |
|---|---|
| Pentane | +36 |
| 2,2-dimethylpropane | +9 |
Why does pentane have the higher boiling point?
Choose your answer
Pentane has more electrons
Pentane has permanent dipole–dipole forces
Pentane has stronger covalent bonds
Pentane has greater surface contact between its molecules